About 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide
2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide (PubChem CID 47289780) has the molecular formula C11H13N5O3
and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
| PubChem CID | 47289780 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2ccc(=O)n(C)c2=O)n[nH]1 |
| InChI | InChI=1S/C11H13N5O3/c1-7-5-8(14-13-7)12-9(17)6-16-4-3-10(18)15(2)11(16)19/h3-5H,6H2,1-2H3,(H2,12,13,14,17) |
| InChIKey | PJIQNZPYASZPEQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide?
The IUPAC name of 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide (CID 47289780) is 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide.
What is the SMILES notation for 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide?
The canonical SMILES for 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide is Cc1cc(NC(=O)Cn2ccc(=O)n(C)c2=O)n[nH]1.
What is the InChIKey of 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide?
The InChIKey is PJIQNZPYASZPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O3/c1-7-5-8(14-13-7)12-9(17)6-16-4-3-10(18)15(2)11(16)19/h3-5H,6H2,1-2H3,(H2,12,13,14,17).
What are the key properties of 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide?
2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide has a molecular weight of 263.26 g/mol, XLogP of -0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2,4-dioxopyrimidin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide is sourced from PubChem (CID 47289780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).