C10H7ClN6O2 — CID 47290059
6-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]imidazo[1,2-a]pyridine (PubChem CID 47290059) has the molecular formula C10H7ClN6O2 and a molecular weight of 278.66 g/mol. Its IUPAC name is 6-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 47290059 |
| Molecular Formula | C10H7ClN6O2 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 6-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ncn(Cc2cn3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C10H7ClN6O2/c11-7-1-2-9-13-8(4-15(9)3-7)5-16-6-12-10(14-16)17(18)19/h1-4,6H,5H2 |
| InChIKey | ONGKEYKKFAGDRH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|