About 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide
5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide (PubChem CID 47292812) has the molecular formula C11H14ClN3O3S
and a molecular weight of 303.77 g/mol. Its IUPAC name is 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide |
| PubChem CID | 47292812 |
| Molecular Formula | C11H14ClN3O3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NCC2CCS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O3S/c12-9-3-8(10(13)16)5-15-11(9)14-4-7-1-2-19(17,18)6-7/h3,5,7H,1-2,4,6H2,(H2,13,16)(H,14,15) |
| InChIKey | GRRSKBBNHGGUBD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide?
The IUPAC name of 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide (CID 47292812) is 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide.
What is the SMILES notation for 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide?
The canonical SMILES for 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide is NC(=O)c1cnc(NCC2CCS(=O)(=O)C2)c(Cl)c1.
What is the InChIKey of 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide?
The InChIKey is GRRSKBBNHGGUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN3O3S/c12-9-3-8(10(13)16)5-15-11(9)14-4-7-1-2-19(17,18)6-7/h3,5,7H,1-2,4,6H2,(H2,13,16)(H,14,15).
What are the key properties of 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide?
5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide has a molecular weight of 303.77 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxamide is sourced from PubChem (CID 47292812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).