About N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide
N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 47292928) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide |
| PubChem CID | 47292928 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nccc(C(=O)NCC(C)(C)CN(C)C)n1 |
| InChI | InChI=1S/C13H22N4O/c1-10-14-7-6-11(16-10)12(18)15-8-13(2,3)9-17(4)5/h6-7H,8-9H2,1-5H3,(H,15,18) |
| InChIKey | REPVWHGGBKJDBC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide?
The IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide (CID 47292928) is N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide.
What is the SMILES notation for N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide?
The canonical SMILES for N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide is Cc1nccc(C(=O)NCC(C)(C)CN(C)C)n1.
What is the InChIKey of N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide?
The InChIKey is REPVWHGGBKJDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O/c1-10-14-7-6-11(16-10)12(18)15-8-13(2,3)9-17(4)5/h6-7H,8-9H2,1-5H3,(H,15,18).
What are the key properties of N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide?
N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide has a molecular weight of 250.35 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methylpyrimidine-4-carboxamide is sourced from PubChem (CID 47292928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).