C24H13ClN4O2S — CID 4729295
2-(1,3-benzothiazol-2-yl)-3-[2-(2-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile (PubChem CID 4729295) has the molecular formula C24H13ClN4O2S and a molecular weight of 456.91 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[2-(2-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[2-(2-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4729295 |
| Molecular Formula | C24H13ClN4O2S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[2-(2-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1c(Oc2ccccc2Cl)nc2ccccn2c1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H13ClN4O2S/c25-17-7-1-3-9-19(17)31-22-16(24(30)29-12-6-5-11-21(29)28-22)13-15(14-26)23-27-18-8-2-4-10-20(18)32-23/h1-13H |
| InChIKey | RCTZJPWZSLJISV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|