C10H11N5OS — CID 47298329
4-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]phenol (PubChem CID 47298329) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 4-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]phenol.
| Compound Name | 4-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 47298329 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]phenol |
| SMILES | Nc1nc(N)nc(CSc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H11N5OS/c11-9-13-8(14-10(12)15-9)5-17-7-3-1-6(16)2-4-7/h1-4,16H,5H2,(H4,11,12,13,14,15) |
| InChIKey | VJQQKVHSYSEEOD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |