C28H23NO5 — CID 4730179
4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-phenyl-1-(2-phenylethyl)-2H-pyrrol-5-one (PubChem CID 4730179) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-phenyl-1-(2-phenylethyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-phenyl-1-(2-phenylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4730179 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-phenyl-1-(2-phenylethyl)-2H-pyrrol-5-one |
| SMILES | COc1cccc2cc(C(=O)C3=C(O)C(=O)N(CCc4ccccc4)C3c3ccccc3)oc12 |
| InChI | InChI=1S/C28H23NO5/c1-33-21-14-8-13-20-17-22(34-27(20)21)25(30)23-24(19-11-6-3-7-12-19)29(28(32)26(23)31)16-15-18-9-4-2-5-10-18/h2-14,17,24,31H,15-16H2,1H3 |
| InChIKey | AKWIRAYELUPMAY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |