About 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline
7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline (PubChem CID 4730380) has the molecular formula C22H15Br2N3
and a molecular weight of 481.19 g/mol. Its IUPAC name is 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline |
| PubChem CID | 4730380 |
| Molecular Formula | C22H15Br2N3 |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 478.96 |
| IUPAC Name | 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline |
| SMILES | Cc1ccc(Cn2c3nc4ccccc4nc3c3cc(Br)cc(Br)c32)cc1 |
| InChI | InChI=1S/C22H15Br2N3/c1-13-6-8-14(9-7-13)12-27-21-16(10-15(23)11-17(21)24)20-22(27)26-19-5-3-2-4-18(19)25-20/h2-11H,12H2,1H3 |
| InChIKey | MDMCQCGJJFOUAH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline?
The IUPAC name of 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline (CID 4730380) is 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline.
What is the SMILES notation for 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline?
The canonical SMILES for 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline is Cc1ccc(Cn2c3nc4ccccc4nc3c3cc(Br)cc(Br)c32)cc1.
What is the InChIKey of 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline?
The InChIKey is MDMCQCGJJFOUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Br2N3/c1-13-6-8-14(9-7-13)12-27-21-16(10-15(23)11-17(21)24)20-22(27)26-19-5-3-2-4-18(19)25-20/h2-11H,12H2,1H3.
What are the key properties of 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline?
7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline has a molecular weight of 481.19 g/mol, XLogP of 6.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dibromo-6-[(4-methylphenyl)methyl]indolo[3,2-b]quinoxaline is sourced from PubChem (CID 4730380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).