About 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine
3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 4730530) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 4730530 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1ccc(-c2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C13H11N3O/c1-17-11-7-5-10(6-8-11)13-15-14-12-4-2-3-9-16(12)13/h2-9H,1H3 |
| InChIKey | STBXJRZEOGTEBM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine (CID 4730530) is 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine is COc1ccc(-c2nnc3ccccn23)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is STBXJRZEOGTEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-17-11-7-5-10(6-8-11)13-15-14-12-4-2-3-9-16(12)13/h2-9H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine?
3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 225.25 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 4730530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).