About 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine
3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 4730542) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 4730542 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | c1coc(-c2nnc3ccccn23)c1 |
| InChI | InChI=1S/C10H7N3O/c1-2-6-13-9(5-1)11-12-10(13)8-4-3-7-14-8/h1-7H |
| InChIKey | MHHLHKMUMIBULZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine (CID 4730542) is 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine is c1coc(-c2nnc3ccccn23)c1.
What is the InChIKey of 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is MHHLHKMUMIBULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c1-2-6-13-9(5-1)11-12-10(13)8-4-3-7-14-8/h1-7H.
What are the key properties of 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine?
3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 185.19 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 4730542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).