C13H17BrF3NO2 — CID 4730656
2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,2-trifluoroethyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4730656) has the molecular formula C13H17BrF3NO2 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,2-trifluoroethyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,2-trifluoroethyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4730656 |
| Molecular Formula | C13H17BrF3NO2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,2-trifluoroethyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)NCC(F)(F)F)(C(Br)C1=O)C2(C)C |
| InChI | InChI=1S/C13H17BrF3NO2/c1-10(2)11(3)4-5-12(10,7(14)8(11)19)9(20)18-6-13(15,16)17/h7H,4-6H2,1-3H3,(H,18,20) |
| InChIKey | XPYVXBMOLCPOGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|