C13H17N5O — CID 47307477
1-propan-2-yl-3-[3-(1,2,4-triazol-1-ylmethyl)phenyl]urea (PubChem CID 47307477) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-propan-2-yl-3-[3-(1,2,4-triazol-1-ylmethyl)phenyl]urea.
| Compound Name | 1-propan-2-yl-3-[3-(1,2,4-triazol-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 47307477 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-propan-2-yl-3-[3-(1,2,4-triazol-1-ylmethyl)phenyl]urea |
| SMILES | CC(C)NC(=O)Nc1cccc(Cn2cncn2)c1 |
| InChI | InChI=1S/C13H17N5O/c1-10(2)16-13(19)17-12-5-3-4-11(6-12)7-18-9-14-8-15-18/h3-6,8-10H,7H2,1-2H3,(H2,16,17,19) |
| InChIKey | IULIHQBCXXABIH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |