C13H19NO4 — CID 4730749
N,N,5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide (PubChem CID 4730749) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N,N,5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide.
| Compound Name | N,N,5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide |
|---|---|
| PubChem CID | 4730749 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N,N,5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide |
| SMILES | CN(C)C(=O)C12CCC(C)(C(=O)OC1=O)C2(C)C |
| InChI | InChI=1S/C13H19NO4/c1-11(2)12(3)6-7-13(11,8(15)14(4)5)10(17)18-9(12)16/h6-7H2,1-5H3 |
| InChIKey | LSNGZNHEEACLJA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|