C13H20N2O4 — CID 4730785
N',N',5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carbohydrazide (PubChem CID 4730785) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N',N',5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carbohydrazide.
| Compound Name | N',N',5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carbohydrazide |
|---|---|
| PubChem CID | 4730785 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N',N',5,8,8-pentamethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C12CCC(C)(C(=O)OC1=O)C2(C)C |
| InChI | InChI=1S/C13H20N2O4/c1-11(2)12(3)6-7-13(11,8(16)14-15(4)5)10(18)19-9(12)17/h6-7H2,1-5H3,(H,14,16) |
| InChIKey | PSYSXVGAULDFKP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|