C16H26N2O3 — CID 4731008
N-tert-butyl-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide (PubChem CID 4731008) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-tert-butyl-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide.
| Compound Name | N-tert-butyl-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
|---|---|
| PubChem CID | 4731008 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-tert-butyl-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1(C)CC2(C)CC(C)(C1)C(=O)NC2=O |
| InChI | InChI=1S/C16H26N2O3/c1-13(2,3)18-12(21)16(6)8-14(4)7-15(5,9-16)11(20)17-10(14)19/h7-9H2,1-6H3,(H,18,21)(H,17,19,20) |
| InChIKey | BSZUTEVZKXQYIV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|