C18H28N2O3 — CID 4731068
1,5,7-trimethyl-7-(4-methylpiperidine-1-carbonyl)-3-azabicyclo[3.3.1]nonane-2,4-dione (PubChem CID 4731068) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1,5,7-trimethyl-7-(4-methylpiperidine-1-carbonyl)-3-azabicyclo[3.3.1]nonane-2,4-dione.
| Compound Name | 1,5,7-trimethyl-7-(4-methylpiperidine-1-carbonyl)-3-azabicyclo[3.3.1]nonane-2,4-dione |
|---|---|
| PubChem CID | 4731068 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1,5,7-trimethyl-7-(4-methylpiperidine-1-carbonyl)-3-azabicyclo[3.3.1]nonane-2,4-dione |
| SMILES | CC1CCN(C(=O)C2(C)CC3(C)CC(C)(C2)C(=O)NC3=O)CC1 |
| InChI | InChI=1S/C18H28N2O3/c1-12-5-7-20(8-6-12)15(23)18(4)10-16(2)9-17(3,11-18)14(22)19-13(16)21/h12H,5-11H2,1-4H3,(H,19,21,22) |
| InChIKey | KMFBXNRCISPTLW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|