About [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone
[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 4731615) has the molecular formula C17H17N3OS2
and a molecular weight of 343.48 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 4731615 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-c3nc4ccccc4s3)s2)CC1 |
| InChI | InChI=1S/C17H17N3OS2/c1-19-8-10-20(11-9-19)17(21)15-7-6-14(22-15)16-18-12-4-2-3-5-13(12)23-16/h2-7H,8-11H2,1H3 |
| InChIKey | ANUXWACIDXZBAX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone (CID 4731615) is [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)c2ccc(-c3nc4ccccc4s3)s2)CC1.
What is the InChIKey of [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone?
The InChIKey is ANUXWACIDXZBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3OS2/c1-19-8-10-20(11-9-19)17(21)15-7-6-14(22-15)16-18-12-4-2-3-5-13(12)23-16/h2-7H,8-11H2,1H3.
What are the key properties of [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone?
[5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone has a molecular weight of 343.48 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-benzothiazol-2-yl)thiophen-2-yl]-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 4731615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).