C9H14N2O4S — CID 47318772
N-(2-methylpropyl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 47318772) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(2-methylpropyl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(2-methylpropyl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 47318772 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2-methylpropyl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | CC(C)CNC(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C9H14N2O4S/c1-6(2)5-11-9(12)7-3-4-8(15-7)16(10,13)14/h3-4,6H,5H2,1-2H3,(H,11,12)(H2,10,13,14) |
| InChIKey | KHYKPHYTQAAAND-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |