About N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide (PubChem CID 47320515) has the molecular formula C13H23N3O2S2
and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide |
| PubChem CID | 47320515 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide |
| SMILES | Cc1nc(C)c(C(C)NS(=O)(=O)N2CCCCCC2)s1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-10-13(19-12(3)14-10)11(2)15-20(17,18)16-8-6-4-5-7-9-16/h11,15H,4-9H2,1-3H3 |
| InChIKey | LEKALJXKTLWXRZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide?
The IUPAC name of N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide (CID 47320515) is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide.
What is the SMILES notation for N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide?
The canonical SMILES for N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide is Cc1nc(C)c(C(C)NS(=O)(=O)N2CCCCCC2)s1.
What is the InChIKey of N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide?
The InChIKey is LEKALJXKTLWXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S2/c1-10-13(19-12(3)14-10)11(2)15-20(17,18)16-8-6-4-5-7-9-16/h11,15H,4-9H2,1-3H3.
What are the key properties of N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide?
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide has a molecular weight of 317.48 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]azepane-1-sulfonamide is sourced from PubChem (CID 47320515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).