C13H16BrN3O2 — CID 47322636
4-bromo-N-[2-(cyclopropylcarbamoylamino)ethyl]benzamide (PubChem CID 47322636) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is 4-bromo-N-[2-(cyclopropylcarbamoylamino)ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-(cyclopropylcarbamoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 47322636 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-bromo-N-[2-(cyclopropylcarbamoylamino)ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Br)cc1)NC1CC1 |
| InChI | InChI=1S/C13H16BrN3O2/c14-10-3-1-9(2-4-10)12(18)15-7-8-16-13(19)17-11-5-6-11/h1-4,11H,5-8H2,(H,15,18)(H2,16,17,19) |
| InChIKey | IBYZLQGZNZQYCN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|