About 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea
1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea (PubChem CID 47324781) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 47324781 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea |
| SMILES | COCCN(C)C(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C9H15N3O2S/c1-7-6-10-8(15-7)11-9(13)12(2)4-5-14-3/h6H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | VTANFANGXKBCIX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea (CID 47324781) is 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea is COCCN(C)C(=O)Nc1ncc(C)s1.
What is the InChIKey of 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The InChIKey is VTANFANGXKBCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-7-6-10-8(15-7)11-9(13)12(2)4-5-14-3/h6H,4-5H2,1-3H3,(H,10,11,13).
What are the key properties of 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea has a molecular weight of 229.30 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 47324781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).