C15H21NOS2 — CID 47327417
N-(2-cyclopentylsulfanylphenyl)-2-methylsulfanylpropanamide (PubChem CID 47327417) has the molecular formula C15H21NOS2 and a molecular weight of 295.47 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-2-methylsulfanylpropanamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 47327417 |
| Molecular Formula | C15H21NOS2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C15H21NOS2/c1-11(18-2)15(17)16-13-9-5-6-10-14(13)19-12-7-3-4-8-12/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | YCYCRYWQBUGWEX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |