About 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide
2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide (PubChem CID 47328190) has the molecular formula C12H15BrFN3O2
and a molecular weight of 332.17 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide |
| PubChem CID | 47328190 |
| Molecular Formula | C12H15BrFN3O2 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNC(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H15BrFN3O2/c1-17(2)11(18)7-16-12(19)15-6-8-5-9(14)3-4-10(8)13/h3-5H,6-7H2,1-2H3,(H2,15,16,19) |
| InChIKey | YBEGPWRIRWODOS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide (CID 47328190) is 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide is CN(C)C(=O)CNC(=O)NCc1cc(F)ccc1Br.
What is the InChIKey of 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide?
The InChIKey is YBEGPWRIRWODOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrFN3O2/c1-17(2)11(18)7-16-12(19)15-6-8-5-9(14)3-4-10(8)13/h3-5H,6-7H2,1-2H3,(H2,15,16,19).
What are the key properties of 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide?
2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide has a molecular weight of 332.17 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-bromo-5-fluorophenyl)methylcarbamoylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 47328190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).