C11H10BrF3N2O2S — CID 47330525
(E)-3-(5-bromothiophen-2-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide (PubChem CID 47330525) has the molecular formula C11H10BrF3N2O2S and a molecular weight of 371.18 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 47330525 |
| Molecular Formula | C11H10BrF3N2O2S |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3N2O2S/c12-8-3-1-7(20-8)2-4-9(18)16-5-10(19)17-6-11(13,14)15/h1-4H,5-6H2,(H,16,18)(H,17,19)/b4-2+ |
| InChIKey | KYHAVYIXOZPUHW-DUXPYHPUSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|