About N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide
N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 47333314) has the molecular formula C9H15N5O2S
and a molecular weight of 257.32 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide |
| PubChem CID | 47333314 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C9H15N5O2S/c1-14(2)5-3-4-10-7(15)8(16)12-9-13-11-6-17-9/h6H,3-5H2,1-2H3,(H,10,15)(H,12,13,16) |
| InChIKey | JKPLLMSIKOGUCV-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide?
The IUPAC name of N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide (CID 47333314) is N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide.
What is the SMILES notation for N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide?
The canonical SMILES for N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide is CN(C)CCCNC(=O)C(=O)Nc1nncs1.
What is the InChIKey of N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide?
The InChIKey is JKPLLMSIKOGUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2S/c1-14(2)5-3-4-10-7(15)8(16)12-9-13-11-6-17-9/h6H,3-5H2,1-2H3,(H,10,15)(H,12,13,16).
What are the key properties of N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide?
N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide has a molecular weight of 257.32 g/mol, XLogP of -0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)propyl]-N'-(1,3,4-thiadiazol-2-yl)oxamide is sourced from PubChem (CID 47333314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).