C8H12N4O2S — CID 47335932
N',N'-diethyl-N-(1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 47335932) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is N',N'-diethyl-N-(1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N',N'-diethyl-N-(1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 47335932 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N',N'-diethyl-N-(1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | CCN(CC)C(=O)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H12N4O2S/c1-3-12(4-2)7(14)6(13)10-8-11-9-5-15-8/h5H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | JWODQRSGSUJYOE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|