C14H19BrN2O2 — CID 47335979
N-(3-bromophenyl)-N',N'-dipropyloxamide (PubChem CID 47335979) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(3-bromophenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 47335979 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(3-bromophenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-3-8-17(9-4-2)14(19)13(18)16-12-7-5-6-11(15)10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,16,18) |
| InChIKey | BEUIVCIHKKTURI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|