C12H20N4O2S — CID 47336117
N',N'-bis(2-methylpropyl)-N-(1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 47336117) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is N',N'-bis(2-methylpropyl)-N-(1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N',N'-bis(2-methylpropyl)-N-(1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 47336117 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N',N'-bis(2-methylpropyl)-N-(1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C12H20N4O2S/c1-8(2)5-16(6-9(3)4)11(18)10(17)14-12-15-13-7-19-12/h7-9H,5-6H2,1-4H3,(H,14,15,17) |
| InChIKey | HPOPLQIBGQSTGH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|