About N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 47340179) has the molecular formula C10H10N4O4S
and a molecular weight of 282.28 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| PubChem CID | 47340179 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H10N4O4S/c15-7-2-1-6(12-13-7)9(17)11-3-4-14-8(16)5-19-10(14)18/h1-2H,3-5H2,(H,11,17)(H,13,15) |
| InChIKey | PORWFXWJVCDCML-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide?
The IUPAC name of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide (CID 47340179) is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide.
What is the SMILES notation for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide?
The canonical SMILES for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide is O=C(NCCN1C(=O)CSC1=O)c1ccc(=O)[nH]n1.
What is the InChIKey of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide?
The InChIKey is PORWFXWJVCDCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4S/c15-7-2-1-6(12-13-7)9(17)11-3-4-14-8(16)5-19-10(14)18/h1-2H,3-5H2,(H,11,17)(H,13,15).
What are the key properties of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide?
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide has a molecular weight of 282.28 g/mol, XLogP of -0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-6-oxo-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 47340179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).