About N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine
N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 47350101) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine.
Molecular Properties
| Compound Name | N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine |
| PubChem CID | 47350101 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | CCCCOCCNc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C11H20N4O3/c1-4-5-7-18-8-6-12-11-10(15(16)17)9(2)13-14(11)3/h12H,4-8H2,1-3H3 |
| InChIKey | SLVJIXIGOANRFM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine?
The IUPAC name of N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine (CID 47350101) is N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine.
What is the SMILES notation for N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine?
The canonical SMILES for N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine is CCCCOCCNc1c([N+](=O)[O-])c(C)nn1C.
What is the InChIKey of N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine?
The InChIKey is SLVJIXIGOANRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c1-4-5-7-18-8-6-12-11-10(15(16)17)9(2)13-14(11)3/h12H,4-8H2,1-3H3.
What are the key properties of N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine?
N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine has a molecular weight of 256.31 g/mol, XLogP of 1.87, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-butoxyethyl)-1,3-dimethyl-4-nitropyrazol-5-amine is sourced from PubChem (CID 47350101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).