C15H20INO3 — CID 47350798
methyl 2-[(2-iodo-3-methylbenzoyl)amino]-2-methylpentanoate (PubChem CID 47350798) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is methyl 2-[(2-iodo-3-methylbenzoyl)amino]-2-methylpentanoate.
| Compound Name | methyl 2-[(2-iodo-3-methylbenzoyl)amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 47350798 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 2-[(2-iodo-3-methylbenzoyl)amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)c1cccc(C)c1I)C(=O)OC |
| InChI | InChI=1S/C15H20INO3/c1-5-9-15(3,14(19)20-4)17-13(18)11-8-6-7-10(2)12(11)16/h6-8H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | UNMKJTPXFJQZCK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|