C13H21N3OS — CID 47350810
N-(5-methyl-2-propan-2-ylcyclohexyl)thiadiazole-5-carboxamide (PubChem CID 47350810) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-(5-methyl-2-propan-2-ylcyclohexyl)thiadiazole-5-carboxamide.
| Compound Name | N-(5-methyl-2-propan-2-ylcyclohexyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 47350810 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(5-methyl-2-propan-2-ylcyclohexyl)thiadiazole-5-carboxamide |
| SMILES | CC1CCC(C(C)C)C(NC(=O)c2cnns2)C1 |
| InChI | InChI=1S/C13H21N3OS/c1-8(2)10-5-4-9(3)6-11(10)15-13(17)12-7-14-16-18-12/h7-11H,4-6H2,1-3H3,(H,15,17) |
| InChIKey | BSVMZVKLZJBGPP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |