About N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide (PubChem CID 47354795) has the molecular formula C14H18BrN3O
and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide |
| PubChem CID | 47354795 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C14H18BrN3O/c1-3-10(4-2)14(19)16-7-12-9-18-8-11(15)5-6-13(18)17-12/h5-6,8-10H,3-4,7H2,1-2H3,(H,16,19) |
| InChIKey | FIYIPHRVHNTOFN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide (CID 47354795) is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide is CCC(CC)C(=O)NCc1cn2cc(Br)ccc2n1.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide?
The InChIKey is FIYIPHRVHNTOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN3O/c1-3-10(4-2)14(19)16-7-12-9-18-8-11(15)5-6-13(18)17-12/h5-6,8-10H,3-4,7H2,1-2H3,(H,16,19).
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide?
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide has a molecular weight of 324.22 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-ethylbutanamide is sourced from PubChem (CID 47354795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).