C22H15ClN4O5S — CID 4736114
2-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 4736114) has the molecular formula C22H15ClN4O5S and a molecular weight of 482.91 g/mol. Its IUPAC name is 2-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | 2-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 4736114 |
| Molecular Formula | C22H15ClN4O5S |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | COc1ccc(N2C(S)=C(C#N)C(=O)NC2c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)cc1 |
| InChI | InChI=1S/C22H15ClN4O5S/c1-31-14-5-2-12(3-6-14)26-20(25-21(28)16(11-24)22(26)33)19-9-8-18(32-19)15-7-4-13(27(29)30)10-17(15)23/h2-10,20,33H,1H3,(H,25,28) |
| InChIKey | XJVSNUZWMSEBLZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|