About N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide (PubChem CID 47363953) has the molecular formula C14H13N3OS
and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide |
| PubChem CID | 47363953 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C14H13N3OS/c1-9-17-10(8-19-9)6-16-14(18)12-7-15-13-5-3-2-4-11(12)13/h2-5,7-8,15H,6H2,1H3,(H,16,18) |
| InChIKey | UZQBKIFBJPXEFF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide?
The IUPAC name of N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide (CID 47363953) is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide.
What is the SMILES notation for N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide?
The canonical SMILES for N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide is Cc1nc(CNC(=O)c2c[nH]c3ccccc23)cs1.
What is the InChIKey of N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide?
The InChIKey is UZQBKIFBJPXEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS/c1-9-17-10(8-19-9)6-16-14(18)12-7-15-13-5-3-2-4-11(12)13/h2-5,7-8,15H,6H2,1H3,(H,16,18).
What are the key properties of N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide?
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide has a molecular weight of 271.35 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-3-carboxamide is sourced from PubChem (CID 47363953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).