C19H14N4O3S — CID 4736563
4-[hydroxy(pyridin-4-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 4736563) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-[hydroxy(pyridin-4-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy(pyridin-4-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4736563 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[hydroxy(pyridin-4-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | Cc1nnc(N2C(=O)C(=O)C(=C(O)c3ccncc3)C2c2ccccc2)s1 |
| InChI | InChI=1S/C19H14N4O3S/c1-11-21-22-19(27-11)23-15(12-5-3-2-4-6-12)14(17(25)18(23)26)16(24)13-7-9-20-10-8-13/h2-10,15,24H,1H3 |
| InChIKey | DVUDBWAEJWMFJJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|