About 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide
3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide (PubChem CID 47365771) has the molecular formula C13H11Cl3N2OS
and a molecular weight of 349.67 g/mol. Its IUPAC name is 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide |
| PubChem CID | 47365771 |
| Molecular Formula | C13H11Cl3N2OS |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide |
| SMILES | CCc1ccsc1C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2OS/c1-2-7-3-4-20-12(7)13(19)18-17-11-9(15)5-8(14)6-10(11)16/h3-6,17H,2H2,1H3,(H,18,19) |
| InChIKey | VMMWEFGGQSPJDL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide?
The IUPAC name of 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide (CID 47365771) is 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide.
What is the SMILES notation for 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide?
The canonical SMILES for 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide is CCc1ccsc1C(=O)NNc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide?
The InChIKey is VMMWEFGGQSPJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl3N2OS/c1-2-7-3-4-20-12(7)13(19)18-17-11-9(15)5-8(14)6-10(11)16/h3-6,17H,2H2,1H3,(H,18,19).
What are the key properties of 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide?
3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide has a molecular weight of 349.67 g/mol, XLogP of 5.03, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N'-(2,4,6-trichlorophenyl)thiophene-2-carbohydrazide is sourced from PubChem (CID 47365771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).