C18H25N3S — CID 4736624
N,2-ditert-butyl-4H-[1,3]thiazino[3,2-a]benzimidazol-4-amine (PubChem CID 4736624) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is N,2-ditert-butyl-4H-[1,3]thiazino[3,2-a]benzimidazol-4-amine.
| Compound Name | N,2-ditert-butyl-4H-[1,3]thiazino[3,2-a]benzimidazol-4-amine |
|---|---|
| PubChem CID | 4736624 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N,2-ditert-butyl-4H-[1,3]thiazino[3,2-a]benzimidazol-4-amine |
| SMILES | CC(C)(C)NC1C=C(C(C)(C)C)Sc2nc3ccccc3n21 |
| InChI | InChI=1S/C18H25N3S/c1-17(2,3)14-11-15(20-18(4,5)6)21-13-10-8-7-9-12(13)19-16(21)22-14/h7-11,15,20H,1-6H3 |
| InChIKey | WSMJLIISQBYSAG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |