C16H20N2O — CID 4736825
3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-ol (PubChem CID 4736825) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-ol.
| Compound Name | 3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-ol |
|---|---|
| PubChem CID | 4736825 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-ol |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C16H20N2O/c1-11-15-13(9-16(2,3)10-14(15)19)18(17-11)12-7-5-4-6-8-12/h4-8,14,19H,9-10H2,1-3H3 |
| InChIKey | GZFQZWPGQSJZQQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |