About 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid
1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (PubChem CID 4736916) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| PubChem CID | 4736916 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| SMILES | CN1N=C(C(=O)O)CCC1=O |
| InChI | InChI=1S/C6H8N2O3/c1-8-5(9)3-2-4(7-8)6(10)11/h2-3H2,1H3,(H,10,11) |
| InChIKey | QAMPBVPSOZEYTC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid?
The IUPAC name of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (CID 4736916) is 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid.
What is the SMILES notation for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid?
The canonical SMILES for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid is CN1N=C(C(=O)O)CCC1=O.
What is the InChIKey of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid?
The InChIKey is QAMPBVPSOZEYTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-8-5(9)3-2-4(7-8)6(10)11/h2-3H2,1H3,(H,10,11).
What are the key properties of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid?
1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylic acid is sourced from PubChem (CID 4736916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).