C11H18N2O3 — CID 4737
5-ethyl-5-pentan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 4737) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-ethyl-5-pentan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-pentan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4737 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-ethyl-5-pentan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(C)C1(CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | WEXRUCMBJFQVBZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|