About N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide (PubChem CID 47371964) has the molecular formula C12H16ClNO2S2
and a molecular weight of 305.85 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide |
| PubChem CID | 47371964 |
| Molecular Formula | C12H16ClNO2S2 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClNO2S2/c1-8(2)18(15,16)14-11-5-6-17-12-4-3-9(13)7-10(11)12/h3-4,7-8,11,14H,5-6H2,1-2H3 |
| InChIKey | LCZGUDLUGVPSKE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide?
The IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide (CID 47371964) is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide.
What is the SMILES notation for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide?
The canonical SMILES for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide is CC(C)S(=O)(=O)NC1CCSc2ccc(Cl)cc21.
What is the InChIKey of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide?
The InChIKey is LCZGUDLUGVPSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO2S2/c1-8(2)18(15,16)14-11-5-6-17-12-4-3-9(13)7-10(11)12/h3-4,7-8,11,14H,5-6H2,1-2H3.
What are the key properties of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide?
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide has a molecular weight of 305.85 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)propane-2-sulfonamide is sourced from PubChem (CID 47371964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).