C5H4N4O2 — CID 4737428
4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 4737428) has the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. Its IUPAC name is 4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 4737428 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | O=C1CC(=O)n2ncnc2N1 |
| InChI | InChI=1S/C5H4N4O2/c10-3-1-4(11)9-5(8-3)6-2-7-9/h2H,1H2,(H,6,7,8,10) |
| InChIKey | HIPUIIULBPMUGO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|