C18H16N2S — CID 4737470
1-pyridin-4-yl-2-thiophen-2-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 4737470) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-pyridin-4-yl-2-thiophen-2-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-pyridin-4-yl-2-thiophen-2-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 4737470 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-pyridin-4-yl-2-thiophen-2-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | c1csc(N2CCc3ccccc3C2c2ccncc2)c1 |
| InChI | InChI=1S/C18H16N2S/c1-2-5-16-14(4-1)9-12-20(17-6-3-13-21-17)18(16)15-7-10-19-11-8-15/h1-8,10-11,13,18H,9,12H2 |
| InChIKey | RPYMCKOIYUNZFZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |