About 2-(3,4-dihydroisoquinolin-1-yl)acetic acid
2-(3,4-dihydroisoquinolin-1-yl)acetic acid (PubChem CID 4737805) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(3,4-dihydroisoquinolin-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,4-dihydroisoquinolin-1-yl)acetic acid |
| PubChem CID | 4737805 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(3,4-dihydroisoquinolin-1-yl)acetic acid |
| SMILES | O=C(O)CC1=NCCc2ccccc21 |
| InChI | InChI=1S/C11H11NO2/c13-11(14)7-10-9-4-2-1-3-8(9)5-6-12-10/h1-4H,5-7H2,(H,13,14) |
| InChIKey | DHEWATZGVNADNM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dihydroisoquinolin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydroisoquinolin-1-yl)acetic acid?
The IUPAC name of 2-(3,4-dihydroisoquinolin-1-yl)acetic acid (CID 4737805) is 2-(3,4-dihydroisoquinolin-1-yl)acetic acid.
What is the SMILES notation for 2-(3,4-dihydroisoquinolin-1-yl)acetic acid?
The canonical SMILES for 2-(3,4-dihydroisoquinolin-1-yl)acetic acid is O=C(O)CC1=NCCc2ccccc21.
What is the InChIKey of 2-(3,4-dihydroisoquinolin-1-yl)acetic acid?
The InChIKey is DHEWATZGVNADNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-11(14)7-10-9-4-2-1-3-8(9)5-6-12-10/h1-4H,5-7H2,(H,13,14).
What are the key properties of 2-(3,4-dihydroisoquinolin-1-yl)acetic acid?
2-(3,4-dihydroisoquinolin-1-yl)acetic acid has a molecular weight of 189.21 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroisoquinolin-1-yl)acetic acid is sourced from PubChem (CID 4737805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).