C11H8N4O — CID 4737814
14-amino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-one (PubChem CID 4737814) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 14-amino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-one.
| Compound Name | 14-amino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 4737814 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 14-amino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaen-2-one |
| SMILES | Nc1cccc2nc3ncccc3c(=O)n12 |
| InChI | InChI=1S/C11H8N4O/c12-8-4-1-5-9-14-10-7(3-2-6-13-10)11(16)15(8)9/h1-6H,12H2 |
| InChIKey | YBBQYXNKNKPGLV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|