C12H16Cl2N2O3S — CID 47378185
N-(4-amino-3,5-dichlorophenyl)-2-propylsulfonylpropanamide (PubChem CID 47378185) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-propylsulfonylpropanamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-propylsulfonylpropanamide |
|---|---|
| PubChem CID | 47378185 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-propylsulfonylpropanamide |
| SMILES | CCCS(=O)(=O)C(C)C(=O)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-3-4-20(18,19)7(2)12(17)16-8-5-9(13)11(15)10(14)6-8/h5-7H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | CZNSBWLVRNNHOI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|