About 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol
4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol (PubChem CID 4738378) has the molecular formula C13H12N2OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol |
| PubChem CID | 4738378 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol |
| SMILES | Oc1ccc(C2=NNC(c3cccs3)C2)cc1 |
| InChI | InChI=1S/C13H12N2OS/c16-10-5-3-9(4-6-10)11-8-12(15-14-11)13-2-1-7-17-13/h1-7,12,15-16H,8H2 |
| InChIKey | MMWDGORNVLUSIC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol?
The IUPAC name of 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol (CID 4738378) is 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol.
What is the SMILES notation for 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol?
The canonical SMILES for 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol is Oc1ccc(C2=NNC(c3cccs3)C2)cc1.
What is the InChIKey of 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol?
The InChIKey is MMWDGORNVLUSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS/c16-10-5-3-9(4-6-10)11-8-12(15-14-11)13-2-1-7-17-13/h1-7,12,15-16H,8H2.
What are the key properties of 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol?
4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol has a molecular weight of 244.32 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol is sourced from PubChem (CID 4738378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).