About 3-chloroisoindol-1-one
3-chloroisoindol-1-one (PubChem CID 4738466) has the molecular formula C8H4ClNO
and a molecular weight of 165.58 g/mol. Its IUPAC name is 3-chloroisoindol-1-one.
Molecular Properties
| Compound Name | 3-chloroisoindol-1-one |
| PubChem CID | 4738466 |
| Molecular Formula | C8H4ClNO |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.00 |
| IUPAC Name | 3-chloroisoindol-1-one |
| SMILES | O=C1N=C(Cl)c2ccccc21 |
| InChI | InChI=1S/C8H4ClNO/c9-7-5-3-1-2-4-6(5)8(11)10-7/h1-4H |
| InChIKey | BFYDTPYCUVVKGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroisoindol-1-one?
The IUPAC name of 3-chloroisoindol-1-one (CID 4738466) is 3-chloroisoindol-1-one.
What is the SMILES notation for 3-chloroisoindol-1-one?
The canonical SMILES for 3-chloroisoindol-1-one is O=C1N=C(Cl)c2ccccc21.
What is the InChIKey of 3-chloroisoindol-1-one?
The InChIKey is BFYDTPYCUVVKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNO/c9-7-5-3-1-2-4-6(5)8(11)10-7/h1-4H.
What are the key properties of 3-chloroisoindol-1-one?
3-chloroisoindol-1-one has a molecular weight of 165.58 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroisoindol-1-one is sourced from PubChem (CID 4738466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).