About 1-phenyl-6,7-dihydro-5H-indazol-4-one
1-phenyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 4738557) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-phenyl-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 1-phenyl-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 4738557 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-phenyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1CCCc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C13H12N2O/c16-13-8-4-7-12-11(13)9-14-15(12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | PSXCLWPFIRHOJO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 1-phenyl-6,7-dihydro-5H-indazol-4-one (CID 4738557) is 1-phenyl-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 1-phenyl-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 1-phenyl-6,7-dihydro-5H-indazol-4-one is O=C1CCCc2c1cnn2-c1ccccc1.
What is the InChIKey of 1-phenyl-6,7-dihydro-5H-indazol-4-one?
The InChIKey is PSXCLWPFIRHOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c16-13-8-4-7-12-11(13)9-14-15(12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2.
What are the key properties of 1-phenyl-6,7-dihydro-5H-indazol-4-one?
1-phenyl-6,7-dihydro-5H-indazol-4-one has a molecular weight of 212.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 4738557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).